![Asperglaucin B [2701570-80-9] Asperglaucin B [2701570-80-9]](https://www.targetmol.com/group3/M00/3F/15/CgoaEGbZj4eEMmoHAAAAADXJmy0916.png)
Asperglaucin B [2701570-80-9]
T75468
Overview
- SupplierTargetMol Chemicals
- Product NameAsperglaucin B [2701570-80-9]
- Delivery Days Customer999
- CAS Number2701570-80-9
- Category SupplierChemical
- CertificationResearch Use Only
- Chemical NameAsperglaucin B
- Molecular FormulaC19H26O3
- Molecular Weight302.41
- Scientific DescriptionAsperglaucin B, an alkylated salicylaldehyde derivative isolated from the fungus Aspergillus chevalieri SQ-8, exhibits significant antibacterial properties. This compound demonstrates potent activity against the plant pathogens Pseudomonas syringae pv actinidae (Psa) and Bacillus cereus, achieving a minimum inhibitory concentration (MIC) value of 6.25 microM [1].
- Shelf life instruction3 years
- SMILESC(=O)C1=C2C(=CC(O)=C1CCCCCCC)C=CC(C)(C)O2
- Storage Instruction-20°C
- UNSPSC12352200