![BDP R6G carboxylic acid [174881-57-3] BDP R6G carboxylic acid [174881-57-3]](https://www.targetmol.com/group3/M00/3F/22/CgoaEGbkG1KERdhXAAAAAMHO44U447.png)
BDP R6G carboxylic acid [174881-57-3]
T85832
Overview
- SupplierTargetMol Chemicals
- Product NameBDP R6G carboxylic acid [174881-57-3]
- Delivery Days Customer16
- CertificationResearch Use Only
- Molecular FormulaC18H15BF2N2O2
- Molecular Weight340.13
- Scientific DescriptionBDP R6G carboxylic acid, a borondipyrromethene dye (Excitation: 530 nM; Emission: 548 nM), features a terminal carboxylic acid group that can react with primary amine groups in the presence of activators to form a stable amide bond. This allows for further labeling reactions, such as Steglich esterification [1].
- SMILESF[B-]1([N+]2=C(C3=CC=CC=C3)C=CC2=CC4=CC=C(CCC([O-])=O)N41)F.[H+]
- Storage Instruction-20°C
- UNSPSC12352200