![Byzantionoside B [189109-45-3] Byzantionoside B [189109-45-3]](https://www.targetmol.com/group3/M00/02/A5/CgoaEGY7OaKEGARuAAAAAOgxH2o638.png)
Byzantionoside B [189109-45-3]
TN3552
Molecular Weight372.45
Product group Chemicals
Overview
- SupplierTargetMol Chemicals
- Product NameByzantionoside B [189109-45-3]
- Delivery Days Customer9
- CertificationResearch Use Only
- Molecular FormulaC19H32O7
- Molecular Weight372.45
- Scientific DescriptionByzantionoside B shows stimulatory activity on human osteoblast cells, it may have the potential to stimulate bone formation and regeneration.
- SMILESC[C@@H](CC[C@H]1C(C)=CC(=O)CC1(C)C)O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O
- Storage Instruction-20°C
- UNSPSC12352200