![C-2-Decoumaroylaloeresin G [1059182-21-6] C-2-Decoumaroylaloeresin G [1059182-21-6]](https://www.targetmol.com/group3/M00/02/42/CgoaEGY7LfKEHm7CAAAAANVZD5I264.png)
C-2-Decoumaroylaloeresin G [1059182-21-6]
T82799
Overview
- SupplierTargetMol Chemicals
- Product NameC-2-Decoumaroylaloeresin G [1059182-21-6]
- Delivery Days Customer999
- Category SupplierChemical
- CertificationResearch Use Only
- Chemical NameC-2′-Decoumaroylaloeresin G
- Molecular FormulaC20H24O8
- Molecular Weight392.4
- Scientific DescriptionCompound 1059182-21-6 features a cyclic structure characterized by a nitrogen atom occupying an apex (corner) within the heterocycle. Its molecular scaffold integrates aromatic properties due to the presence of a conjugated system, while the inclusion of hydroxyl (-OH) groups confers reactive potential for subsequent modification. Additionally, a halogenated component, specifically a bromine atom, is attached to the aromatic ring, enhancing its propensity for undergoing further synthetic transformations.
- Shelf life instruction3 years
- SMILESO(C)C=1C(=C2C(=C(C)C1)C(=O)C=C(/C=C/C)O2)[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O
- Storage Instruction-20°C
- UNSPSC12352200