Dimethyl lithospermate B
HY-N6868
Overview
- SupplierMedChem Express
- Product NameDimethyl lithospermate B [875313-64-7]
- Delivery Days Customer10
- CAS Number875313-64-7
- CertificationResearch Use Only
- Estimated Purity99.77
- Molecular FormulaC38H34O16
- Molecular Weight746.67
- Scientific DescriptionDimethyl lithospermate B (dmLSB) is a selective Na+ channel agonist. Dimethyl lithospermate B slows inactivation of sodium current (INa), leading to increased inward current during the early phases of the action potential (AP)[1][2].
- SMILESOC1=C(O)C=CC(C[C@H](C(OC)=O)OC([C@H]2C3=C(/C=C/C(O[C@@H](C(OC)=O)CC4=CC(O)=C(O)C=C4)=O)C=CC(O)=C3O[C@@H]2C5=CC(O)=C(O)C=C5)=O)=C1
- Storage Instruction-20°C
- UNSPSC12352200