Ganoderic acid B (Standard)
HY-N2006R
Product group Assays
Overview
- SupplierMedChem Express
- Product NameGanoderic acid B (Standard) [81907-61-1]
- Delivery Days Customer999
- CAS Number81907-61-1
- CertificationResearch Use Only
- Molecular FormulaC30H44O7
- Molecular Weight516.67
- Scientific DescriptionGanoderic acid B (Standard) is the analytical standard of Ganoderic acid B. This product is intended for research and analytical applications. Ganoderic acid B is a triterpene isolated from a mushroom Ganoderma lucidum. Ganoderic acid B inhibits the activation of Epstein-Barr virus (EBV) antigens as telomerase inhibitor. Ganoderic acid B is a moderately active inhibitor against HIV-1 protease (IC50: 170 microM)[1][2][3].
- SMILESC[C@]([C@@]([C@]([C@H](C)CC(C[C@@H](C)C(O)=O)=O)([H])C1)(CC2=O)C)(C1=O)C([C@H](C[C@@]3([H])C4(C)C)O)=C2[C@]3(CC[C@@H]4O)C
- UNSPSC12352200