![Guajadial B [1414455-03-0] Guajadial B [1414455-03-0]](https://www.targetmol.com/group3/M00/03/34/CgoaEWY7RJqEarm3AAAAAF-UZCc010.png)
Guajadial B [1414455-03-0]
TN4172
Molecular Weight474.597
Product group Chemicals
Overview
- SupplierTargetMol Chemicals
- Product NameGuajadial B [1414455-03-0]
- Delivery Days Customer9
- CertificationResearch Use Only
- Molecular FormulaC30H34O5
- Molecular Weight474.597
- Scientific DescriptionGuajadial B acts as a Top1 catalytic inhibitor and delays Top1 poison-mediated DNA damage. Guajadial B shows cytotoxicities against five human cancer cell lines, it is the most effective having an IC50 value of 150 nM toward A549 cells.
- SMILESC\C1=C/CC(C)(C)\C=C\C[C@@]2(C)Oc3c(C=O)c(O)c(C=O)c(O)c3[C@H]([C@@H]2CC1)c1ccccc1
- Storage Instruction-20°C
- UNSPSC12352200