![Monensin B [30485-16-6] Monensin B [30485-16-6]](https://www.targetmol.com/group3/M00/03/65/CgoaEWY7SmeECy_WAAAAAKTMBto264.png)
Monensin B [30485-16-6]
T40383
Overview
- SupplierTargetMol Chemicals
- Product NameMonensin B [30485-16-6]
- Delivery Days Customer999
- CAS Number30485-16-6
- Category SupplierChemical
- CertificationResearch Use Only
- Chemical NameMonensin B
- Molecular FormulaC35H60O11
- Molecular Weight656.854
- Scientific DescriptionMonensin B is a polyketide compound derived from the bacterium Streptomyces cinnamonensis. Its production involves the fermentation of Streptomyces cinnamonensis, resulting in a mixture of Monensin A and Monensin B. The ratio of these two compounds depends on the concentrations of ethylmalonyl-CoA and methylmalonyl-CoA.
- Shelf life instruction3 years
- SMILES[H][C@@]1(C[C@H](C)[C@@]([H])(O1)[C@]1(C)CC[C@@]([H])(O1)[C@]1(C)CC[C@]2(C[C@H](O)[C@@H](C)[C@]([H])(O2)[C@@H](C)[C@@H](OC)[C@H](C)C(O)=O)O1)[C@@]1([H])O[C@@](O)(CO)[C@H](C)C[C@@H]1C
- Storage Instruction-20°C
- UNSPSC12352200