![Rhapontisterone B [698975-64-3] Rhapontisterone B [698975-64-3]](https://www.targetmol.com/group3/M00/02/CC/CgoaEWY7OLGEXPSHAAAAALrXGSI356.png)
Rhapontisterone B [698975-64-3]
TN4908
CAS Number698975-64-3
Product group Chemicals
Molecular Weight480.642
Overview
- SupplierTargetMol Chemicals
- Product NameRhapontisterone B [698975-64-3]
- Delivery Days Customer9
- CAS Number698975-64-3
- CertificationResearch Use Only
- Molecular FormulaC27H44O7
- Molecular Weight480.642
- Scientific DescriptionRhapontisterone B is a natural product of Rhaponticum, Asteraceae. The catalog number is TN4908 and the CAS number is 698975-64-3. Rhapontisterone B can be used as a reference standard.
- SMILES[H][C@@]1(CC[C@@]2(O)C3=CC(=O)[C@@]4([H])C[C@H](O)[C@H](O)C[C@]4(C)[C@@]3([H])CC[C@]12C)[C@@](C)(O)[C@H](O)CCC(C)(C)O
- Storage Instruction-20°C
- UNSPSC12352200