
Chemical Structure
Rhodamine B [81-88-9] [81-88-9]
CDX-R0003
CAS Number81-88-9
Product group Chemicals
Estimated Purity>95%
Molecular Weight479.01
Overview
- SupplierChemodex
- Product NameRhodamine B [81-88-9] [81-88-9]
- Delivery Days Customer10
- CAS Number81-88-9
- CertificationResearch Use Only
- Estimated Purity>95%
- Hazard InformationDanger
- Molecular FormulaC28H31ClN2O3
- Molecular Weight479.01
- Scientific DescriptionChemical. CAS: 81-88-9. Formula: C28H31ClN2O3. MW: 479.01. Soluble in water (10mg/ml), ethanol (20mg/ml) or DMSO. Rhodamine B is a fluorescent xanthene dye widely used in various applications, including histology, due to its bright red to pink fluorescence when exposed to ultraviolet (UV) light. Rhodamine B is used as a tracer dye in water studies to track the movement of water, determine flow rates, and identify leaks in systems. It is commonly used in microscopy and flow cytometry for staining cells and tissues due to its ability to bind to cellular components and emit fluorescence. Rhodamine B is employed as a gain medium in dye lasers, where it helps in generating coherent light. Rhodamine B is tunable around 610nm when used as a laser dye. Rhodamine B has been incorporated in a FRET system based on lanthanide-doped nanoparticles for monitoring biological effects and has been used as a mitochondrial probe to study the energetic state of multi-drug resistant and sensitive cells. Rhodamine B is also a valuable tool in fluorescence microscopy and other fluorescence-based techniques. Spectral Data: lambdaex=554nm, lambdaem=627nm (EtOH). lambdaex=546nm, lambdaem=567nm (DMSO). Rhodamine B is used in the textile industry to dye fabrics, providing vibrant colors. - Rhodamine B is a fluorescent xanthene dye widely used in various applications, including histology, due to its bright red to pink fluorescence when exposed to ultraviolet (UV) light. Rhodamine B is used as a tracer dye in water studies to track the movement of water, determine flow rates, and identify leaks in systems. It is commonly used in microscopy and flow cytometry for staining cells and tissues due to its ability to bind to cellular components and emit fluorescence. Rhodamine B is employed as a gain medium in dye lasers, where it helps in generating coherent light. Rhodamine B is tunable around 610nm when used as a laser dye. Rhodamine B has been incorporated in a FRET system based on lanthanide-doped nanoparticles for monitoring biological effects and has been used as a mitochondrial probe to study the energetic state of multi-drug resistant and sensitive cells. Rhodamine B is also a valuable tool in fluorescence microscopy and other fluorescence-based techniques. Spectral Data: lambdaex=554nm, lambdaem=627nm (EtOH). lambdaex=546nm, lambdaem=567nm (DMSO). Rhodamine B is used in the textile industry to dye fabrics, providing vibrant colors.
- SMILESCCN(CC)C1=CC2=[O+]C(C=C(C=C3)N(CC)CC)=C3C(C(C=CC=C4)=C4C(O)=O)=C2C=C1.[Cl-]
- Storage InstructionRT
- UNSPSC12162000





![Rhodamine B [81-88-9]](https://www.targetmol.com/group3/M00/36/F7/CgoaEWayRlqEWmmLAAAAALByv2Q623.png)