![Salvianolic acid B [121521-90-2] Salvianolic acid B [121521-90-2]](https://www.targetmol.com/group3/M00/35/68/CgoaEGayHlmEe-hYAAAAAC9wOQA694.png)
Salvianolic acid B [121521-90-2]
T5725
CAS Number121521-90-2
Product group Chemicals
Estimated Purity99.86%
Molecular Weight718.61
Overview
- SupplierTargetMol Chemicals
- Product NameSalvianolic acid B
- Delivery Days Customer4
- CAS Number121521-90-2
- Category SupplierChemical
- CertificationResearch Use Only
- Chemical NameSalvianolic acid B
- Estimated Purity99.86%
- Molecular FormulaC36H30O16
- Molecular Weight718.61
- Scientific DescriptionSalvianolic acid B is a water-soluble antioxidant from Salvia extract. Salvianolic acid B plays significant role of antioxidant effect; antiplatelet aggregation, anticoagulant, and antithrombotic effect.
- Shelf life instruction3 years
- SMILESOC(=O)[C@@H](Cc1ccc(O)c(O)c1)OC(=O)\C=C\c1ccc(O)c2O[C@@H]([C@@H](C(=O)O[C@H](Cc3ccc(O)c(O)c3)C(O)=O)c12)c1ccc(O)c(O)c1
- Storage Instruction-20°C
- UNSPSC12352200