![Tanshindiol B [97465-70-8] Tanshindiol B [97465-70-8]](https://www.targetmol.com/group3/M00/03/1D/CgoaEGY7R2SEYnXLAAAAALCTetw014.png)
Tanshindiol B [97465-70-8]
TN5096
Molecular Weight312.32
Product group Chemicals
Overview
- SupplierTargetMol Chemicals
- Product NameTanshindiol B [97465-70-8]
- Delivery Days Customer9
- CertificationResearch Use Only
- Molecular FormulaC18H16O5
- Molecular Weight312.32
- Scientific DescriptionTanshindiol B possesses a unique anti-cancer activity whose mechanism involves the inhibition of EZH2 activity and would provide chemically valuable information for designing a new class of potent EZH2 inhibitors. It also possesses the anti-angiogenic activity,so it can be a promising candidate for angiogenesis inhibitors.
- SMILESO=C1C=2C(C3=C(C1=O)C(C)=CO3)=CC=C4C2CC[C@H](O)[C@]4(C)O
- Storage Instruction-20°C
- UNSPSC12352200