1-Adamantanol [768-95-6] [768-95-6]

Chemodex

1-Adamantanol [768-95-6] [768-95-6]

10

768-95-6

Research Use Only

>99%

C10H16O

152.23

1-Adamantanol is a compound that functions as a versatile building block in organic synthesis. It serves as a precursor for the preparation of various derivatives, including polymers, and specialty chemicals. Its mechanism of action involves participating in a range of chemical reactions, such as esterification, etherification and oxidation, to yield structurally diverse products. 1-Adamantanols molecular structure allows it to undergo selective functionalization, enabling the creation of new compounds with tailored properties. Its role in the synthesis of complex molecules may be useful for exploring the structure-activity relationships of organic compounds. At the molecular level, 1-Adamantanols functional groups facilitate its reactivity, leading to the formation of novel chemical entities with potential applications in various fields of study. - Chemical. CAS: 768-95-6. Formula: C10H16O. MW: 152.23. 1-Adamantanol is a compound that functions as a versatile building block in organic synthesis. It serves as a precursor for the preparation of various derivatives, including polymers, and specialty chemicals. Its mechanism of action involves participating in a range of chemical reactions, such as esterification, etherification and oxidation, to yield structurally diverse products. 1-Adamantanols molecular structure allows it to undergo selective functionalization, enabling the creation of new compounds with tailored properties. Its role in the synthesis of complex molecules may be useful for exploring the structure-activity relationships of organic compounds. At the molecular level, 1-Adamantanols functional groups facilitate its reactivity, leading to the formation of novel chemical entities with potential applications in various fields of study.

OC12C[C@H](C3)C[C@@H](C2)C[C@H]3C1

-20°C,2°C to 8°C

12352200