(2S)-OMPT [645408-61-3]
HY-120967A
CAS Number645408-61-3
Product group Chemicals
Molecular Weight466.61
Overview
- SupplierMedChem Express
- Product Name(2S)-OMPT [645408-61-3]
- Delivery Days Customer5
- CAS Number645408-61-3
- CertificationResearch Use Only
- Molecular FormulaC22H43O6PS
- Molecular Weight466.61
- Scientific Description(2S)-OMPT triethylamine, a chiral oxirane derivative, is commonly used as a ligand in asymmetric catalysis, especially in the enantioselective synthesis of bioactive molecules such as amino acids and drugs. (2S)-OMPT triethylamine has unique chemical properties that allow it to selectively bind certain metal complexes and activate them in a way that favors the formation of specific enantiomers.
- SMILESCCCCCCCC/C=C\CCCCCCCC(OC[C@H](OC)COP(O)(S)=O)=O
- UNSPSC12352200