3,3-Dipropyloxadicarbocyanine iodide [53213-90-4] [53213-90-4]

Chemodex

3,3-Dipropyloxadicarbocyanine iodide [53213-90-4] [53213-90-4]

10

Research Use Only

>97.5% (HPLC)

Warning

C25H27IN2O2

514.41

Chemical. CAS: 53213-90-4. Formula: C25H27IN2O2. MW: 514.41. DiOC3(5) is a fluorescent carbocyanine dye used to measure mitochondrial or bacterial membrane potential or for nucleic acid staining, by binding to DNA and RNA. It can be used for flow cytometry and live cell microscopy. Carbocyanine dyes are unique organic molecules that contain a conjugated electron-deficient system between two heterocyclic nitrogen atoms that provides characteristically long absorption and emission wavelengths. Spectral Data: Excitation max: ~577nm, Emission max: ~595-640nm (accord. Lit). Intermediate for the synthesis of fluorescent probes. - DiOC3(5) is a fluorescent carbocyanine dye used to measure mitochondrial or bacterial membrane potential or for nucleic acid staining, by binding to DNA and RNA. It can be used for flow cytometry and live cell microscopy. Carbocyanine dyes are unique organic molecules that contain a conjugated electron-deficient system between two heterocyclic nitrogen atoms that provides characteristically long absorption and emission wavelengths. Spectral Data: Excitation max: ~577nm, Emission max: ~595-640nm (accord. Lit). Intermediate for the synthesis of fluorescent probes.

[I-].O1C=2C=CC=CC2N(C1=CC=CC=CC=3OC=4C=CC=CC4[N+]3CCC)CCC

-20°C,2°C to 8°C

12162000