7-Fluoro-2,1,3- benzoxadiazole-4-sulfonylchloride [91366-64-2] [91366-64-2]

Chemodex

7-Fluoro-2,1,3- benzoxadiazole-4-sulfonylchloride [91366-64-2] [91366-64-2]

10

91366-64-2

Research Use Only

>95%

Danger,Excepted quantity

C6H2ClFN2O3S

236.61

4-(Chlorosulfonyl)-7-fluoro-2,1,3-benzoxadiazole is a versatile nucleophilic intermediate or building block for the synthesis of thiol-reactive fluorogenic probes, like ADB-F, SBD-F or DBD-F. It is characterized by its unique chlorosulfonyl group that enhances electrophilic reactivity. The presence of the fluorine atom increases the compounds polarity, promoting strong dipole interactions. This compound exhibits rapid reaction kinetics, particularly in nucleophilic substitution reactions, making it an intriguing subject for exploring mechanistic pathways and reactivity profiles in synthetic chemistry. - Chemical. CAS: 91366-64-2. Formula: C6H2ClFN2O3S. MW: 236.61. 4-(Chlorosulfonyl)-7-fluoro-2,1,3-benzoxadiazole is a versatile nucleophilic intermediate or building block for the synthesis of thiol-reactive fluorogenic probes, like ADB-F, SBD-F or DBD-F. It is characterized by its unique chlorosulfonyl group that enhances electrophilic reactivity. The presence of the fluorine atom increases the compounds polarity, promoting strong dipole interactions. This compound exhibits rapid reaction kinetics, particularly in nucleophilic substitution reactions, making it an intriguing subject for exploring mechanistic pathways and reactivity profiles in synthetic chemistry.

FC1=CC=C(S(=O)(Cl)=O)C2=NON=C21

-20°C,2°C to 8°C

UN3261

12162000