8-Amino-6-methoxyquinoline [90-52-8] [90-52-8]

Chemodex

8-Amino-6-methoxyquinoline [90-52-8] [90-52-8]

10

90-52-8

Research Use Only

>95%

Warning

C10H10N2O

174.2

8-Amino-6-methoxyquinoline is a versatile intermediate or buliding block in medicinal chemistry and analytical research. 8-Amino-6-methoxyquinoline serves as a key intermediate in the synthesis of various pharmaceuticals, particularly antimicrobial, antibacterial, antifungal, antimalarial or neuroprotective substances. It is employed in the development of fluorescent probes for biological imaging, allowing researchers to visualize cellular processes in real-time. It is used as a reagent in various analytical techniques, including chromatography and spectroscopy, to detect and quantify other chemical substances, enhancing the accuracy of analytical results. - Chemical. CAS: 90-52-8. Formula: C10H10N2O. MW: 174.2. 8-Amino-6-methoxyquinoline is a versatile intermediate or buliding block in medicinal chemistry and analytical research. 8-Amino-6-methoxyquinoline serves as a key intermediate in the synthesis of various pharmaceuticals, particularly antimicrobial, antibacterial, antifungal, antimalarial or neuroprotective substances. It is employed in the development of fluorescent probes for biological imaging, allowing researchers to visualize cellular processes in real-time. It is used as a reagent in various analytical techniques, including chromatography and spectroscopy, to detect and quantify other chemical substances, enhancing the accuracy of analytical results.

NC=1C2=C(C=C(OC)C1)C=CC=N2

2°C to 8°C

12352200