![Alisol B 23-acetate [26575-95-1] Alisol B 23-acetate [26575-95-1]](https://www.targetmol.com/group3/M00/35/75/CgoaEGayH9SEEIphAAAAAKrAnME879.png)
Alisol B 23-acetate [26575-95-1]
T6S2246
CAS Number26575-95-1
Product group Chemicals
Estimated Purity99.87%
Molecular Weight514.74
Overview
- SupplierTargetMol Chemicals
- Product NameAlisol B 23-acetate [26575-95-1]
- Delivery Days Customer9
- CAS Number26575-95-1
- CertificationResearch Use Only
- Chemical NameAlisol B 23-acetate
- Estimated Purity99.87%
- Molecular FormulaC32H50O5
- Molecular Weight514.74
- Scientific Description1. Alisol B 23-acetate (Alisol B Acetate) produces protective effect against ANIT-induced hepatotoxity and cholestasis, due to FXR-mediated regulation of transporters and enzymes. 2. Alisol B 23-acetate produces promotive effect on liver regeneration, due to FXR-mediated regulation of genes involved in hepatocyte proliferation and hepato-protection. 3. Alisol B 23-acetate produces a protective effect against CCl4-induced hepatotoxicity, due to FXR and STAT3-mediated gene regulation.
- Shelf life instruction3 years
- SMILESC[C@H](C[C@H](OC(C)=O)[C@H]1OC1(C)C)C1=C2C[C@H](O)[C@H]3[C@@]4(C)CCC(=O)C(C)(C)[C@@H]4CC[C@]3(C)[C@@]2(C)CC1
- Storage Instruction-20°C
- UNSPSC12352200