![Alisol B acetate [19865-76-0] Alisol B acetate [19865-76-0]](https://www.targetmol.com/group3/M00/35/80/CgoaEWayIkaEa5CJAAAAAC4yqvw458.png)
Alisol B acetate [19865-76-0]
TN6394
CAS Number19865-76-0
Product group Chemicals
Molecular Weight514.74
Overview
- SupplierTargetMol Chemicals
- Product NameAlisol B acetate [19865-76-0]
- Delivery Days Customer9
- CAS Number19865-76-0
- CertificationResearch Use Only
- Molecular FormulaC32H50O5
- Molecular Weight514.74
- Scientific DescriptionAlisol B acetate can induce Bax nuclear translocation and apoptosis in human hormone-resistant prostate cancer PC-3 cells, the Bax activation and translocation from the cytosol to nucleus might be a crucial response to the apoptotic effect. Alisol B acetate exhibits an antiproliferative effect in SGC7901 cells by inducing apoptosis, apoptosis of SGC7901 cells involves mitochondria-caspase and PI3K/Akt dependent pathways.
- SMILESCC(C)C(=O)[C@H](C[C@@H](C)C1=C2C[C@H](O)[C@H]3[C@@]4(C)CCC(=O)C(C)(C)[C@@H]4CC[C@]3(C)[C@@]2(C)CC1)OC(C)=O
- Storage Instruction-20°C
- UNSPSC12352200