Amphotericin B methyl ester [36148-89-7]
HY-135327
CAS Number36148-89-7
Product group Chemicals
Estimated Purity96.19
Molecular Weight938.11
Overview
- SupplierMedChem Express
- Product NameAmphotericin B methyl ester [36148-89-7]
- Delivery Days Customer5
- CAS Number36148-89-7
- CertificationResearch Use Only
- Estimated Purity96.19
- Hazard Informationh302, h315, h319, h335
- Molecular FormulaC48H75NO17
- Molecular Weight938.11
- Scientific DescriptionAmphotericin B methyl ester is the methyl ester derivative of the polyene antibiotic Amphotericin B (A634250). Amphotericin B methyl ester is the cholesterol-binding compound possesses significant antifungal activity. Amphotericin B methyl ester disrupts HIV-1 particle production and potently inhibits HIV-1 replication[1][2].
- SMILESCOC([C@H]1[C@@]2([H])O[C@](O)(C[C@H](C[C@H]([C@@H](CC[C@H](C[C@H](CC(O[C@H]([C@@H]([C@H](O)[C@@H](C)/C=C/C=C/C=C/C=C/C=C/C=C/C=C/[C@H](O[C@@]3([H])[C@H]([C@H]([C@H](O)[C@@H](C)O3)N)O)C2)C)C)=O)O)O)O)O)O)C[C@@H]1O)=O
- Storage Instruction-20°C
- UNSPSC12352200
![Amphotericin B methyl ester [36148-89-7]](https://www.targetmol.com/group3/M00/02/F2/CgoaEWY7PVOES9MSAAAAABM-Akk098.png)