BP Fluor 430 picolyl azide

MedChem Express

BP Fluor 430 picolyl azide

5

Research Use Only

C31H34F3N7O7S

705.70

BP Fluor 430 Picolyl Azide is an advanced fluorescent probe that incorporatess a copper-chelating motif to raise the effective concentration of Cu(I) at the reaction site. The rate of the CuAAC reaction depends on the concentrations of all reagents, including copper, therefore raising the effective copper concentration at the reaction site will dramatically increase the rate of CuAAC reaction without the need to increase concentration of azide reagent or copper. In addition, the use of BP Fluor 430 Picolyl Azide instead of conventional BP Fluor 430 Azide allows for at least a tenfold reduction in the concentration of the copper catalyst without sacrificing the efficiency of labeling. In summary, the introduction of a picolyl moiety into an azide probe leads to a substantial increase in the sensitivity of alkyne detection. This is of special value for the detection of low abundance targets or where significant increase in signal intensity is desired.

[N-]=[N+]=NCC1=NC=C(NC(CCNC(CCCCCN2C(C=C3O4)=C(C(CS(=O)(O)=O)=CC2(C)C)C=C3C(C(F)(F)F)=CC4=O)=O)=O)C=C1

12162000