![Cacospongionolide B [172854-76-1] Cacospongionolide B [172854-76-1]](https://www.targetmol.com/group3/M00/02/78/CgoaEGY7NFGEJKEqAAAAABztQWY246.png)
Cacospongionolide B [172854-76-1]
T70234
Molecular Weight400.55
Product group Chemicals
Overview
- SupplierTargetMol Chemicals
- Product NameCacospongionolide B [172854-76-1]
- Delivery Days Customer114
- CertificationResearch Use Only
- Chemical NameCacospongionolide B
- Molecular FormulaC25H36O4
- Molecular Weight400.55
- Scientific DescriptionCacospongionolide B is isolated from the sponge Fasciospongia cavernosa. The marine sponge natural product cacospongionolide B (1) is one of a class of compounds bearing a g-hydroxybutenolide which are known to inhibit multiple forms of secratory phospholipase A2,1 enzymes believed to initiate a cascade of biological events leading to inflammation.
- Shelf life instruction3 years
- SMILESC(CC1=CC[C@@H](OC1)C2=CC(=O)O[C@H]2O)[C@]3(C)[C@@]4([C@@](C)(CC[C@@H]3C)C(=C)CCC4)[H]
- Storage Instruction-20°C
- UNSPSC12352200