Cannflavin B [76735-58-5]
HY-W749694
CAS Number76735-58-5
Product group Chemicals
Estimated Purity98.36
Molecular Weight368.38
Overview
- SupplierMedChem Express
- Product NameCannflavin B [76735-58-5]
- Delivery Days Customer14
- CAS Number76735-58-5
- CertificationResearch Use Only
- Estimated Purity98.36
- Molecular FormulaC21H20O6
- Molecular Weight368.38
- Scientific DescriptionCannflavin B is a flavonoid compound that can be isolated from Cannabis sativa L. Cannflavin B is inhibitors of PGE2 release (IC50: 0.7 microM), mPGES-1 (IC50: 3.7 microM), and 5-lipoxygenase. Cannflavin B has multiple activities such as anti-inflammatory, antioxidant, anti-glycation, anti-ferroptosis, anti-tumor, and anti-Leishmania (IC50: 14 microM). Cannflavin B can also inhibit the TrkB-BDNF signaling pathway[1][2][3][4].
- SMILESO=C1C=C(C2=CC(OC)=C(O)C=C2)OC3=CC(O)=C(C/C=C(C)\C)C(O)=C13
- Storage Instruction-20°C
- UNSPSC12352200
![Cannflavin B [76735-58-5]](https://www.targetmol.com/group3/M00/03/23/CgoaEGY7R_OEQcxDAAAAABMqC7U764.png)