Ceratamine B [634151-16-9]
HY-W777429
CAS Number634151-16-9
Product group Chemicals
Molecular Weight454.12
Overview
- SupplierMedChem Express
- Product NameCeratamine B [634151-16-9]
- Delivery Days Customer9
- CAS Number634151-16-9
- CertificationResearch Use Only
- Molecular FormulaC16H14Br2N4O2
- Molecular Weight454.12
- Scientific DescriptionCeratamine B is a fluorescent substrate with significant biological activity and can be used for cell imaging and biolabeling. Ceratamine B can effectively penetrate cell membranes, facilitating the study of cellular processes. Ceratamine B also shows broad application potential in compound screening and biosensor development.
- SMILESO=C1NC=CC2=NC(NC)=NC2=C1CC3=CC(Br)=C(C(Br)=C3)OC
- UNSPSC12352200