Chrysomycin B [83852-56-6]
HY-111320
CAS Number83852-56-6
Product group Chemicals
Molecular Weight496.51
Overview
- SupplierMedChem Express
- Product NameChrysomycin B [83852-56-6]
- Delivery Days Customer10
- CAS Number83852-56-6
- CertificationResearch Use Only
- Molecular FormulaC27H28O9
- Molecular Weight496.51
- Scientific DescriptionChrysomycin B is an antibiotic isolated from a strain of Streptomyces. Chrysomycin B causes DNA damage in the human lung adenocarcinoma A549 cell line and inhibits topoisomerase II. Chrysomycin B suppresses the growth of transplantable tumors in mice.
- SMILESO=C1C2=CC(C)=CC(OC)=C2C3=CC(OC)=C4C(O)=CC=C([C@H]5[C@@H]([C@]([C@H]([C@@H](C)O5)O)(C)O)O)C4=C3O1
- UNSPSC12352200
![Chrysomycin B [83852-56-6]](https://www.targetmol.com/group3/M00/03/48/CgoaEGY7TQqELlMJAAAAANJ4zh4111.png)

