CgoaEWY7PeqEA0l-AAAAAKh8Qmk827.png
Cyclosporin B [63775-95-1]
T19848
CAS Number63775-95-1
Product group Chemicals
Molecular Weight1188.58
Overview
- SupplierTargetMol Chemicals
- Product NameCyclosporin B
- Delivery Days Customer44
- CAS Number63775-95-1
- Category SupplierChemical
- CertificationResearch Use Only
- Chemical NameCyclosporin B
- Molecular FormulaC61H109N11O12
- Molecular Weight1188.58
- Scientific DescriptionCyclosporin B is an immunosuppressant that has revolutionized organ transplantation through its use in the prevention of graft rejection. Cyclosporin B displays antiviral properties, inhibiting the entry of hepatitis B into hepatocytes. Cyclosporin B also inhibits RANKL-induced TRAP phosphatase activity, inducing apoptosis in osteoclasts. Cyclosporin B is a derivative of cyclosporin A that exhibits significantly less immunosuppressive activity.
- Shelf life instruction3 years
- SMILESC\C=C\C[C@@H](C)[C@@H](O)[C@@H]1N(C)C(=O)C(C(C)C)N(C)C(=O)[C@H](CC(C)C)N(C)C(=O)[C@H](CC(C)C)N(C)C(=O)[C@@H](C)NC(=O)[C@H](C)NC(=O)[C@H](CC(C)C)N(C)C(=O)[C@@H](NC(=O)[C@H](CC(C)C)N(C)C(=O)CN(C)C(=O)[C@H](C)NC1=O)C(C)C
- Storage Instruction-20°C
- UNSPSC12352200