DACN(Tos2,6-OH) [2109751-74-6]

TargetMol Chemicals

DACN(Tos2,6-OH) [2109751-74-6]

16

Research Use Only

C21H24N2O5S2

448.56

DACN(Tos2,6-OH) serves as a potent click chemistry reagent featuring an Azide group and a distinctively bent alkyne moiety. This structure enhances its reactivity for cycloaddition reactions compared to nonbent acyclic alkynes, especially evident in cyclononyne alkynes which exhibit substantially higher reactivity. The bent configuration adds both electronic and steric effects that intensify the reactivity, facilitating strain-promoted azide-alkyne cycloaddition (SPAAC). SPAAC with cycloalkynes is commonly utilized for dependable molecular conjugation across various fields. Furthermore, DACN(Tos2,6-OH) can participate in copper-catalyzed azide-alkyne cycloaddition (CuAAc), coupling efficiently with molecules that contain Azide groups. Compared to cyclooctynes, DACNs demonstrate superior thermal and chemical stabilities while maintaining similar click reactivity [1]. Nitrogens within the compound provide versatile linking sites for numerous functional units.

S(=O)(=O)(C1=CC=C(C)C=C1)N2CC(O)CN(S(=O)(=O)C3=CC=C(C)C=C3)CC#CC2

-20°C

12352200