Diosbulbin B [20086-06-0]
HY-N0429
CAS Number20086-06-0
Product group Chemicals
Estimated Purity99.90
Molecular Weight344.36
Overview
- SupplierMedChem Express
- Product NameDiosbulbin B [20086-06-0]
- Delivery Days Customer10
- CAS Number20086-06-0
- CertificationResearch Use Only
- Estimated Purity99.90
- Molecular FormulaC19H20O6
- Molecular Weight344.36
- Scientific DescriptionDiosbulbin B, a diterpene lactone, is an anticancer agent. Diosbulbin B is an orally active component of Dioscorea. bulbifera L. Diosbulbin B can inhibit cell proliferation, induce G0/G1 phase arrest and apoptosis. Diosbulbin B can induce autophagy and mitochondrial dysfunction. Diosbulbin B can induce liver injury. Diosbulbin B can be used for the research of cancer, such as non-small cell lung cancer (NSCLC)[1][2][3].
- SMILESO=C1OC2([H])C3([H])[C@](CC4([H])OC(C3([H])C4)=O)([H])C5(C)C1(C2)O[C@@H](C6=COC=C6)C5
- Storage Instruction-20°C,2°C to 8°C
- UNSPSC12352200
![Diosbulbin B [20086-06-0]](https://www.targetmol.com/group3/M00/36/A6/CgoaEGayQcSER6dCAAAAANWbG78634.png)