Dityrosine hydrochloride [2716849-01-1]

TargetMol Chemicals

Dityrosine hydrochloride [2716849-01-1]

16

Chemical

Research Use Only

Dityrosine hydrochloride

C18H20N2O6?2HCl

433.28

Dityrosine, an oxidation product of protein formed through the intermolecular cross-linking of tyrosyl radicals from the reactive oxygen species (ROS) and tyrosine interaction, is associated with decreased hippocampal expression of NMDA receptor subunits Nr1, Nr2a, and Nr2b when administered intragastrically at 320 microg/kg per day, leading to memory impairments in mice as evidenced by their performance in a novel object recognition test. Additionally, it raises fasting blood glucose levels while reducing plasma insulin levels and the pancreatic expression of insulin synthesis-related genes Ins2, Pdx1, and MafA. Increased dityrosine levels have been positively linked to a range of diseases, including autism spectrum disorder, cataracts, Alzheimers disease, Parkinsons disease, atherosclerosis, and cystic fibrosis.

3 years

OC=1C(=CC(CC(C(O)=O)N)=CC1)C2=CC(CC(C(O)=O)N)=CC=C2O.Cl

-20°C

12352209