Echinocandin B nucleus [79411-15-7]
HY-107211
CAS Number79411-15-7
Product group Chemicals
Molecular Weight797.81
Overview
- SupplierMedChem Express
- Product NameEchinocandin B nucleus [79411-15-7]
- Delivery Days Customer5
- CAS Number79411-15-7
- CertificationResearch Use Only
- Molecular FormulaC34H51N7O15
- Molecular Weight797.81
- Scientific DescriptionEchinocandin B nucleus (A-30912 A nucleus) is the reaction product catalyzed by Echinocandin B (HY-125723) deacylase. Echinocandin B nucleus serves as an intermediate for the synthesis of semi-synthetic antifungal agents[1].
- SMILESO=C1N2[C@@](C(N[C@@H]([C@@H](C[C@@H](C(N[C@@](C(N3[C@](C[C@H](C3)O)([H])C(N[C@@](C(N[C@@]1([H])[C@H](O)C)=O)([H])[C@H](O)[C@H](C4=CC=C(C=C4)O)O)=O)=O)([H])[C@H](O)C)=O)N)O)O)=O)([H])[C@H]([C@H](C2)C)O
- UNSPSC12352200