![Fumitremorgin B [12626-17-4] Fumitremorgin B [12626-17-4]](https://www.targetmol.com/group3/M00/36/97/CgoaEWayQR2EG7jhAAAAAESklQg593.png)
Fumitremorgin B [12626-17-4]
TN4084
CAS Number12626-17-4
Product group Chemicals
Molecular Weight479.57
Overview
- SupplierTargetMol Chemicals
- Product NameFumitremorgin B [12626-17-4]
- Delivery Days Customer9
- CAS Number12626-17-4
- CertificationResearch Use Only
- Molecular FormulaC27H33N3O5
- Molecular Weight479.57
- Scientific DescriptionFumitremorgen B is a mycotoxin, it exhibits a certain degree of genotoxicity, it can cause DNA damage in human lymphocytes; it shows an inhibitory activity on the cell cycle progression of mouse tsFT210 cells in the M phase, with the MIC value of 26.1 microM. Fumitremorgin B exhibits antifungal activities, it also shows significant toxicity toward brine shrimps,with the median lethal concentration (LC(50)) value of 13.6 ug/mL. Fumitremorgin B possesses antifeedant activity against armyworm larvae.
- SMILES[H][C@@]12CCCN1C(=O)[C@]1(O)[C@@H](O)c3c(n(CC=C(C)C)c4cc(OC)ccc34)[C@]([H])(C=C(C)C)N1C2=O
- Storage Instruction-20°C
- UNSPSC12352200