FURA-2-AM [108964-32-5]

Chemodex

FURA 2-AM [108964-32-5]

10

108964-32-5

Research Use Only

>95%

C44H47N3O24

1001.87

Chemical. CAS: 108964-32-5. Formula: C44H47N3O24. MW: 1001.87. Synthetic. The fluorescent probe FURA 2/AM is a membrane-permeable derivative of the calcium chelator FURA 2. Inside cells, FURA 2/AM is rapidly hydrolyzed by cytoplasmic esterases to FURA 2, which remains within the cell. Non-invasive, intracellular calcium indicator that is UV light-excitable. Fluorescent Ca2+ indicator, selective for Ca2+ over other divalent cations Mg2+, Zn2+, Fe2+ and Mn2+. FURA 2/AM is used to determine calcium concentrations in many cellular systems, including: cardiac myocytes, vascular smooth muscle cells and medullary collecting tubules. Spectral properties in the presence of low calcium concentrations (lambdaex = 362nm, lambdaem = 512nm) differ from those during high calcium conditions (lambdaex = 335nm, lambdaem = 505nm). FURA 2 is preferred for ratio-imaging microscopy, in which it is more practical to change excitation wavelengths than emission wavelengths. Spectral Data: lambdaex 355nm; lambdaem 495nm in 0.1 M Tris pH 8.0. - The fluorescent probe FURA 2/AM is a membrane-permeable derivative of the calcium chelator FURA 2. Inside cells, FURA 2/AM is rapidly hydrolyzed by cytoplasmic esterases to FURA 2, which remains within the cell. Non-invasive, intracellular calcium indicator that is UV light-excitable. Fluorescent Ca2+ indicator, selective for Ca2+ over other divalent cations Mg2+, Zn2+, Fe2+ and Mn2+. FURA 2/AM is used to determine calcium concentrations in many cellular systems, including: cardiac myocytes, vascular smooth muscle cells and medullary collecting tubules. Spectral properties in the presence of low calcium concentrations (lambdaex = 362nm, lambdaem = 512nm) differ from those during high calcium conditions (lambdaex = 335nm, lambdaem = 505nm). FURA 2 is preferred for ratio-imaging microscopy, in which it is more practical to change excitation wavelengths than emission wavelengths. Spectral Data: lambdaex 355nm; lambdaem 495nm in 0.1 M Tris pH 8.0.

O=C(OCOC(C)=O)C1=CN=C(O1)C2=CC3=C(O2)C=C(N(CC(OCOC(C)=O)=O)CC(OCOC(C)=O)=O)C(OCCOC4=C(N(CC(OCOC(C)=O)=O)CC(OCOC(C)=O)=O)C=CC(C)=C4)=C3

-20°C

41116134