Ganoderic acid B [81907-61-1]
HY-N2006
CAS Number81907-61-1
Product group Chemicals
Estimated Purity99.60
Molecular Weight516.67
Overview
- SupplierMedChem Express
- Product NameGanoderic acid B [81907-61-1]
- Delivery Days Customer9
- CAS Number81907-61-1
- CertificationResearch Use Only
- Estimated Purity99.60
- Molecular FormulaC30H44O7
- Molecular Weight516.67
- Scientific DescriptionGanoderic acid B is a triterpene isolated from a mushroom Ganoderma lucidum. Ganoderic acid B inhibits the activation of Epstein-Barr virus (EBV) antigens as telomerase inhibitor. Ganoderic acid B is a moderately active inhibitor against HIV-1 protease (IC50: 170 microM)[1][2][3].
- SMILESC[C@]([C@@]([C@]([C@H](C)CC(C[C@@H](C)C(O)=O)=O)([H])C1)(CC2=O)C)(C1=O)C([C@H](C[C@@]3([H])C4(C)C)O)=C2[C@]3(CC[C@@H]4O)C
- Storage Instruction2°C to 8°C
- UNSPSC12352200
![Ganoderic acid B [81907-61-1] [81907-61-1]](https://www.targetmol.com/group3/M00/36/19/CgoaEGayN6OEeHhYAAAAAECmHfc190.png)