![HYPOCRELLIN B [123940-54-5] HYPOCRELLIN B [123940-54-5]](https://www.targetmol.com/group3/M00/35/7F/CgoaEWayIfOEEHWCAAAAAD__gsQ345.png)
HYPOCRELLIN B [123940-54-5]
T5780
CAS Number123940-54-5
Product group Chemicals
Estimated Purity98.87%
Molecular Weight528.51
Overview
- SupplierTargetMol Chemicals
- Product NameHYPOCRELLIN B [123940-54-5]
- Delivery Days Customer4
- CAS Number123940-54-5
- CertificationResearch Use Only
- Chemical NameHYPOCRELLIN B
- Estimated Purity98.87%
- Molecular FormulaC30H24O9
- Molecular Weight528.51
- Scientific DescriptionHYPOCRELLIN B are photosensitive pigments isolated from Hypocrella bambusae Sacc. Hypocrellin B causes DNA strand breakage, induces apoptosis in ovarian cancer cells, and inhibits proliferation of Staphylococcus by increasing ROS levels, and damaging cell walls.
- Shelf life instruction3 years
- SMILESCOc1c(O)c2c3c(O)cc(OC)c4c(OC)cc5C(=O)C(=O)C(OC)=C6CC(C)=c(c1C(C)=O)c2c6c5c34
- Storage Instruction-20°C
- UNSPSC12352200