ICG PEG N3 (MW 3400)

MedChem Express

ICG PEG N3 (MW 3400)

999

Research Use Only

3400 (Average)

ICG PEG N3 (MW 3400) is a Indocyanine green (ICG) (HY-D0711)-azide fluorescent dye used to label for protein and nucleic acid. ICG PEG N3 (MW 3400) is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups (Ex/Em = 785/813 nm).

CC1(C)C(/C=C/C=C/C=C/C=C2N(CCCCCC(NCCOCCN=[N+]=[N-])=O)C(C=CC3=C4C=CC=C3)=C4C/2(C)C)=[N+](CCCCS(=O)([O-])=O)C5=CC=C6C(C=CC=C6)=C51.[n]

12162000