![Kazinol B [99624-27-8] Kazinol B [99624-27-8]](https://www.targetmol.com/group3/M00/03/0E/CgoaEWY7QFiEBvIiAAAAAIpyDXk090.png)
Kazinol B [99624-27-8]
T20232
CAS Number99624-27-8
Product group Chemicals
Estimated Purity98%
Molecular Weight392.49
Overview
- SupplierTargetMol Chemicals
- Product NameKazinol B [99624-27-8]
- Delivery Days Customer9
- CAS Number99624-27-8
- CertificationResearch Use Only
- Chemical NameKazinol B
- Estimated Purity98%
- Molecular FormulaC25H28O4
- Molecular Weight392.49
- Scientific DescriptionKazinol B is an inhibitor of nitric oxide (NO) production, an isopentenylated flavan with a dimethylpyran ring.Kazinol B improves insulin sensitivity by activating the insulin-Akt signalling pathway and AMPK, which enhances glucose uptake.Kazinol B stimulates gene expression and secretion of adiponectin and can be used to study diabetes.
- Shelf life instruction3 years
- SMILESC(C=C(C)C)C1=C(C=C2C(=C1O)OC(C)(C)C=C2)[C@H]3OC=4C(CC3)=CC=C(O)C4
- Storage Instruction-20°C
- UNSPSC12352200