![Lentztrehalose B [1808096-67-4] Lentztrehalose B [1808096-67-4]](https://www.targetmol.com/group3/M00/28/92/CgoaEGZ9RlCEMdJXAAAAAO2hStE014.png)
Lentztrehalose B [1808096-67-4]
TN7284
Molecular Weight410.41
Product group Chemicals
Overview
- SupplierTargetMol Chemicals
- Product NameLentztrehalose B [1808096-67-4]
- Delivery Days Customer999
- CertificationResearch Use Only
- Chemical NameLentztrehalose B
- Molecular FormulaC17H30O11
- Molecular Weight410.41
- Scientific DescriptionLentztrehalose B, a microbial disaccharide metabolite isolated from Lentzea, exhibits a range of biological activities. At a concentration of 100 microM, it demonstrates antioxidant properties in an oxygen radical absorbance capacity (ORAC) assay. Furthermore, Lentztrehalose B at 10 mM inhibits porcine kidney trehalase, an enzyme involved in trehalose metabolism. Additionally, it induces autophagy in MeWo melanoma and OVK18 ovarian cancer cells when applied at 100 mM.
- Shelf life instruction3 years
- SMILESO(CC=C(C)C)[C@@H]1[C@@H](CO)O[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O
- Storage Instruction-20°C
- UNSPSC12352200