![Loureirin B [119425-90-0] Loureirin B [119425-90-0]](https://www.targetmol.com/group3/M00/35/81/CgoaEWayIqOETV8BAAAAAIVUWKk287.png)
Loureirin B [119425-90-0]
T3876
CAS Number119425-90-0
Product group Chemicals
Estimated Purity99.91%
Molecular Weight316.35
Overview
- SupplierTargetMol Chemicals
- Product NameLoureirin B
- Delivery Days Customer9
- CAS Number119425-90-0
- Category SupplierChemical
- CertificationResearch Use Only
- Chemical NameLoureirin B
- Estimated Purity99.91%
- Molecular FormulaC18H20O5
- Molecular Weight316.35
- Scientific DescriptionLoureirin B can downregulate the expression of fibrosis-related molecules by regulating MMPs and TIMPs levels, inhibit scar fibroblast proliferation and suppress TGF-beta1-induced fibrosis, during which TGF-beta1/Smad2/3 pathway is likely involved.
- Shelf life instruction3 years
- SMILESCOc1cc(OC)c(CCC(=O)c2ccc(O)cc2)c(OC)c1
- Storage Instruction-20°C
- UNSPSC12352200