Macrocarpal B [142698-60-0]
HY-N3345
CAS Number142698-60-0
Product group Chemicals
Molecular Weight472.61
Overview
- SupplierMedChem Express
- Product NameMacrocarpal B [142698-60-0]
- Delivery Days Customer10
- CAS Number142698-60-0
- CertificationResearch Use Only
- Molecular FormulaC28H40O6
- Molecular Weight472.61
- Scientific DescriptionMacrocarpal B is an antibacterial compounds. Macrocarpal B can be isolated from the branch of Eucalyptus globulus. Macrocarpal B can be used for the research of periodontal disease[1].
- SMILESOC1=C([C@@H](CC(C)C)[C@@]2(C)CC[C@]3([H])[C@]2([H])[C@@]4([H])[C@@](C4(C)C)([H])CC[C@@]3(C)O)C(O)=C(C=O)C(O)=C1C=O
- UNSPSC12352200
![Macrocarpal B [142698-60-0]](https://www.targetmol.com/group3/M00/02/E3/CgoaEGY7QMuEEoxGAAAAANCNC9s931.png)