![Mytoxin B [105049-15-8] Mytoxin B [105049-15-8]](https://www.targetmol.com/group3/M00/35/88/CgoaEWayI7KEIp3OAAAAAE-OyjA919.png)
Mytoxin B [105049-15-8]
T63713
CAS Number105049-15-8
Product group Chemicals
Molecular Weight528.59
Overview
- SupplierTargetMol Chemicals
- Product NameMytoxin B [105049-15-8]
- Delivery Days Customer72
- CAS Number105049-15-8
- CertificationResearch Use Only
- Chemical NameMytoxin B
- Molecular FormulaC29H36O9
- Molecular Weight528.59
- Scientific DescriptionMytoxin B is a macrocyclic endolipid that acts like LY294002 and is also an ADC cytotoxin (ADC cytotoxin). mytoxin B is able to exploit the PI3K/Akt pathway and thus induce apoptosis.
- Shelf life instruction3 years
- SMILESCC(=O)C12CC\C=C/C(=O)OC3CC4OC5C=C(C)CCC5(COC(=O)\C=C(/CCO1)C2O)C3(C)C41CO1
- Storage Instruction-20°C
- UNSPSC12352200