![N-hydroxy Rhodamine B amide [1115867-62-3] N-hydroxy Rhodamine B amide [1115867-62-3]](https://www.targetmol.com/group3/M00/38/2D/CgoaEWa8jy-EesMzAAAAAFTUDUY805.png)
N-hydroxy Rhodamine B amide [1115867-62-3]
T87002
Molecular Weight457.56
Product group Chemicals
Overview
- SupplierTargetMol Chemicals
- Product NameN-hydroxy Rhodamine B amide [1115867-62-3]
- Delivery Days Customer16
- CertificationResearch Use Only
- Molecular FormulaC28H31N3O3
- Molecular Weight457.56
- Scientific DescriptionN-hydroxy Rhodamine B amide, a ClO- indicator, hydrolyzes to produce fluorescence in the presence of ClO-. The fluorescence intensity of N-hydroxy Rhodamine B amide is proportional to the product, allowing it to be used for quantifying ClO-.
- SMILESON1C2(C=3C(OC=4C2=CC=C(N(CC)CC)C4)=CC(N(CC)CC)=CC3)C=5C(C1=O)=CC=CC5
- Storage Instruction-20°C
- UNSPSC12352200