
Chemical Structure
Neocuproine hemihydrate [484-11-7]
CDX-N0115
CAS Number484-11-7
Product group Chemicals
Estimated Purity>99%
Molecular Weight217.27
Overview
- SupplierChemodex
- Product NameNeocuproine hemihydrate [484-11-7]
- Delivery Days Customer10
- CAS Number484-11-7
- CertificationResearch Use Only
- Estimated Purity>99%
- Hazard InformationDanger
- Molecular FormulaC14H12N2 . 0.5H2O
- Molecular Weight217.27
- Scientific DescriptionChemical. CAS: 484-11-7. Formula: C14H12N2 . 0.5H2O. MW: 217.27. Neocuproine is a complexing reagent, known for its ability to form stable complexes with metal ions, particularly CU2+ ions. This property makes it valuable in various analytical and research applications, including spectrophotometry and electrochemistry. In the presence of CU2+ ions, neocuproine forms a brightly colored complex that can be used for the quantitative determination of copper in solution. The Neocuproine-CU2+ complex exists in a 2:1 ratio with a maximum absorption at 454 nm. Neocuproine is used in complex with Cu2+ as chromogenic oxidant in the total antioxidant capacity assay (CUPRAC method). In addition to its analytical uses, neocuproine and its derivatives have been employed in the field of coordination chemistry to study and synthesize metal complexes. These complexes often have unique properties and are of interest for their potential applications in catalysis, material science, and other areas of chemical research. This compound is also widely used in some biomedical fields, such as in the study of copper metabolism disorders and neurodegenerative diseases and neocuproine-CU2+ complexes have shown biological properties, such as antitumor activity. - Neocuproine is a complexing reagent, known for its ability to form stable complexes with metal ions, particularly CU2+ ions. This property makes it valuable in various analytical and research applications, including spectrophotometry and electrochemistry. In the presence of CU2+ ions, neocuproine forms a brightly colored complex that can be used for the quantitative determination of copper in solution. The Neocuproine-CU2+ complex exists in a 2:1 ratio with a maximum absorption at 454 nm. Neocuproine is used in complex with Cu2+ as chromogenic oxidant in the total antioxidant capacity assay (CUPRAC method). In addition to its analytical uses, neocuproine and its derivatives have been employed in the field of coordination chemistry to study and synthesize metal complexes. These complexes often have unique properties and are of interest for their potential applications in catalysis, material science, and other areas of chemical research. This compound is also widely used in some biomedical fields, such as in the study of copper metabolism disorders and neurodegenerative diseases and neocuproine-CU2+ complexes have shown biological properties, such as antitumor activity.
- SMILESCC1=NC2=C(C=C1)C=CC3=C2N=C(C=C3)C.CC1=NC2=C(C=C1)C=CC3=C2N=C(C=C3)C.O
- Storage InstructionRT
- UNSPSC12162000
![Neocuproine [484-11-7]](https://www.targetmol.com/group3/M00/37/4F/CgoaEGaySwmEJ8dJAAAAAKefCCw688.png)