
Chemical Structure
NU6102
AG-CR1-0020
Overview
- SupplierAdipoGen Life Sciences
- Product NameNU6102
- Delivery Days Customer10
- CAS Number444722-95-6
- CertificationResearch Use Only
- Estimated Purity>98%
- Hazard InformationWarning
- Molecular FormulaC18H22N6O3S
- Molecular Weight402.5
- Scientific DescriptionChemical. CAS: 444722-95-6. Formula: C18H22N6O3S. MW: 402.5. Potent CDK1/cyclin B (IC50 = 9.5 nM) and CDK2/cyclin A3 (IC50 = 5.4 nM) inhibitor. 1000-fold more potent than NU2058. Selective for CDK1 and CDK2 compared to CDK4/D1 (IC50 = 1.6 microM), DYRK1A (IC50 = 0.9 microM), PDK1 (IC50 = 0.8 microM) and ROCK-II (IC50 = 0.6 microM). Inhibits cell growth. - Potent CDK1/cyclin B (IC50 = 9.5 nM) and CDK2/cyclin A3 (IC50 = 5.4 nM) inhibitor [1-3]. 1000-fold more potent than NU2058 [1]. Selective for CDK1 and CDK2 compared to CDK4/D1 (IC50 = 1.6 microM), DYRK1A (IC50 = 0.9 microM), PDK1 (IC50 = 0.8 microM) and ROCK-II (IC50 = 0.6 microM) [1]. Inhibits cell growth [1].
- SMILESNS(=O)(=O)C1=CC=C(NC2=NC3=C(N=CN3)C(OCC3CCCCC3)=N2)C=C1
- Storage Instruction-20°C,2°C to 8°C
- UNSPSC12352200