![Pentagalloylglucose [14937-32-7] Pentagalloylglucose [14937-32-7]](https://www.targetmol.com/group3/M00/36/C7/CgoaEGayQ3yEYAMHAAAAALuYDCw149.png)
Pentagalloylglucose [14937-32-7]
T3794
CAS Number14937-32-7
Product group Chemicals
Estimated Purity99.72%
Molecular Weight940.68
Overview
- SupplierTargetMol Chemicals
- Product NamePentagalloylglucose [14937-32-7]
- Delivery Days Customer4
- CAS Number14937-32-7
- CertificationResearch Use Only
- Chemical NamePentagalloylglucose
- Estimated Purity99.72%
- Molecular FormulaC41H32O26
- Molecular Weight940.68
- Scientific Description1, 2, 3, 4, 6-Pentagalloylglucose (Penta-O-galloyl-beta-D-glucose) and gallic acid from Pistacia lentiscus have antimutagenic and antioxidant activities. 2. 1, 2, 3, 4, 6-Penta-O-galloyl-beta-D-glucose (PGG) possesses potent anti-proliferative and anti-invasive effects, it also has inhibition of inducible nitric oxide synthase and cyclooxygenase-2 activity. 3. PGG may serve as a model for the development of new types of anti-diabetic and anti-metabolic syndrome therapeutics. 4. 1, 2, 3, 4, 6-Penta- O -galloyl-beta- d -glucose has vasodilatory and anti-inflammatory effects, it dilates vascular smooth muscle and suppresses the vascular inflammatory process via endothelium-dependent nitric oxide (NO)/cGMP signaling. 5. 1, 2, 3, 4, 6-Penta-O-galloyl-beta-D-glucose can decrease the level of extracellular hepatitis B virus (HBV) (IC5, 1. microg/ml) in a dose-dependent manner, it also can reduce the HBsAg level by 25% at a concentration of 4 microg/ml; the gallate structure of PGG may play a critical role in the inhibition of anti-HBV activity, suggests that PGG could be a candidate for developing an anti-HBV agent. 6. 1, 2, 3, 4, 6-Penta-O-galloyl-beta-D-glucose has anti-parasitic activity, displays an EC5 value of 67 microM, at least 6.6-fold more effective than the standard drug benznidazole against trypomastigote forms of T. cruzi.
- Shelf life instruction3 years
- SMILESOc1cc(cc(O)c1O)C(=O)OC[C@H]1O[C@@H](OC(=O)c2cc(O)c(O)c(O)c2)[C@H](OC(=O)c2cc(O)c(O)c(O)c2)[C@@H](OC(=O)c2cc(O)c(O)c(O)c2)[C@@H]1OC(=O)c1cc(O)c(O)c(O)c1
- Storage Instruction-20°C
- UNSPSC12352200