Photobiotin (acetate) [96087-38-6]

MedChem Express

Photobiotin (acetate) [96087-38-6]

10

96087-38-6

Research Use Only

C25H39N9O6S

593.70

Photobiotin (acetate)It is a biological probe used to study biochemical processes such as protein interactions and enzymatic reactions. It is a molecule containing a photosensitive group, which can be combined with specific target molecules (such as proteins, nucleic acids, etc.) through photochemical cross-linking technology, so as to realize the labeling and detection of these molecules. During the photosensitive crosslinking process, Photobiotin (acetate)Can participate in the formation of covalent bonds and form stable compounds. In addition, the compound also has high biocompatibility and biological activity, so it is widely used in the field of biomedical research, such as enzymatic research, proteomics, western blotting and other aspects. Photobiotin (acetate) is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.

CC(O)=O.[N-]=[N+]=NC(C=C1)=CC([N+]([O-])=O)=C1NCCCN(C)CCCNC(CCCC[C@H]2[C@]3([H])[C@](NC(N3)=O)([H])CS2)=O

RT

12352200