Polyadenylic acid (potassium) [26763-19-9]

MedChem Express

Polyadenylic acid (potassium) [26763-19-9]

5

26763-19-9

Research Use Only

90.00

Polyadenylic acid potassium, also known as Poly(A), is enzymatically added to messenger RNA (mRNA) in eukaryotic cells to stabilize mRNAs. Poly(A) is used to evaluate binding on cationic liposomes doped with non-ionic nucleolipids. Poly(A) is used in small molecule mRNA targeted drug development to evaluate the binding of potential therapeutic agents such as the Isoquinoline group of alkaloids. Small molecules that could bind to this poly(A) tail could influence and possibly inhibit mRNA function and subsequent protein production in the cell leading to the development of new type of therapeutic agents.

NC1=C2C(N([C@@H]3O[C@H](COP(O)(O[K])=O)[C@@H](O)[C@H]3O)C=N2)=NC=N1.[n]

-20°C

41115811