![Protosappanin B [102036-29-3] Protosappanin B [102036-29-3]](https://www.targetmol.com/group3/M00/35/7D/CgoaEWayIdiEeXgAAAAAAFwFDrw847.png)
Protosappanin B [102036-29-3]
T6S1780
CAS Number102036-29-3
Product group Chemicals
Molecular Weight304.29
Overview
- SupplierTargetMol Chemicals
- Product NameProtosappanin B [102036-29-3]
- Delivery Days Customer9
- CAS Number102036-29-3
- CertificationResearch Use Only
- Chemical NameProtosappanin B
- Molecular FormulaC16H16O6
- Molecular Weight304.29
- Scientific Description1. Protosappanin B (Q-100961) significantly increases cell viability, inhibits cell apoptosis and up-regulates the expression of growth-associated protein 43. 2. Protosappanin B induces the degradation of p53 protein, via activation of a MDM2-dependent ubiquitination process.
- Shelf life instruction3 years
- SMILESOCC1(O)COc2cc(O)ccc2-c2cc(O)c(O)cc2C1
- Storage Instruction-20°C
- UNSPSC12352200