Pyrocatechol sulfate
HY-153993
Molecular Weight190.17
Product group Chemicals
Overview
- SupplierMedChem Express
- Product NamePyrocatechol sulfate [4918-96-1]
- Delivery Days Customer9
- CertificationResearch Use Only
- Molecular FormulaC6H6O5S
- Molecular Weight190.17
- Scientific DescriptionPyrocatechol sulfate, a phenolic metabolite present in human plasma, is associated with the consumption of specific foods such as berries and the condition of gut microbiota. It serves as a potential urinary biomarker for kidney function, dialytic clearance, whole grain consumption, and regular coffee intake. Additionally, Pyrocatechol sulfate, along with other phenolic sulfates, plays a role in modulating various biological functions, including those related to brain health and the rhythmic beating of cardiomyocytes.
- SMILESO=S(O)(OC1=C(O)C=CC=C1)=O
- UNSPSC12352200