Resorufin-beta-D-glucopyranoside [101490-85-1] [101490-85-1]

Chemodex

Resorufin-beta-D-glucopyranoside [101490-85-1] [101490-85-1]

10

101490-85-1

Research Use Only

>90%

C18H17NO8

375.33

Chemical. CAS: 101490-85-1. Formula: C18H17NO8. MW: 375.33. Resorufin-beta-D-glucopyranosid is a non-selective red-fluorogenic substrate. It is a fluorogenic substrate for beta-glucosidase, beta-glucocerebrosidase (GCase) and beta-galactosidase. Upon enzymatic cleavage by the enzymes, the fluorescent hydrolysis product resorufin is released and its fluorescence can be used to quantify enzyme activity. Spectral data of Resorufin: lambdaex=571nm, lambdaem=585nm. It is used in several applications, specifically in compound screens, where it is advantageous because it is less prone to compound autofluorescence, and thus produces less false positives. - Resorufin-beta-D-glucopyranosid is a non-selective red-fluorogenic substrate. It is a fluorogenic substrate for beta-glucosidase, beta-glucocerebrosidase (GCase) and beta-galactosidase. Upon enzymatic cleavage by the enzymes, the fluorescent hydrolysis product resorufin is released and its fluorescence can be used to quantify enzyme activity. Spectral data of Resorufin: lambdaex=571nm, lambdaem=585nm. It is used in several applications, specifically in compound screens, where it is advantageous because it is less prone to compound autofluorescence, and thus produces less false positives.

O=C1C=C2OC3=CC(O[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)=CC=C3N=C2C=C1

-20°C,2°C to 8°C

12162000