Rhodamine B hydrazide [74317-53-6]
HY-123645
CAS Number74317-53-6
Product group Chemicals
Estimated Purity99.87
Molecular Weight456.58
Overview
- SupplierMedChem Express
- Product NameRhodamine B hydrazide [74317-53-6]
- Delivery Days Customer5
- CAS Number74317-53-6
- CertificationResearch Use Only
- Estimated Purity99.87
- Molecular FormulaC28H32N4O2
- Molecular Weight456.58
- Scientific DescriptionRhodamine B hydrazide is a fluorescent derivative based on rhodamine B, containing the spirocyclic structure of Rhodamine B (HY-Y0016), which can be used to detect copper ions (Cu2+), mercury ions, peroxynitrite, hydroxyl radicals and nitric oxide (NO)[1][2][3]. Excitation/emission wavelength: Conventional detection: 510/578 nm. Sulfite detection: 554 nm absorption, 574 nm emission (due to the formation of Rhodamine B fluorescent product).
- SMILESCCN(C1=CC2=C(C3(C4=CC=C(C=C4O2)N(CC)CC)C5=C(C(N3N)=O)C=CC=C5)C=C1)CC
- Storage Instruction2°C to 8°C
- UNSPSC12162000
![Rhodamine B hydrazide [74317-53-6] [74317-53-6]](https://www.targetmol.com/group3/M00/35/67/CgoaEWayHrSEJ1IoAAAAAAN7NEw608.png)